In Python, write a recursive function that returns the first n Fibonacci numbers.

Begin by denoting the first and second Fibonacci number as 0 and 1 respectively. This helps us define a base case for our algorithm. We know that new Fibonacci numbers are formed by adding its 2 predecessors. This will help us define the recursive call.
Code:def Fibonacci(n): if n == 0: return 0 elif n == 1: return 1 else: return Fibonacci(n-1)+Fibonacci(n-2)

MS

Related Computing A Level answers

All answers ▸

How can the idea of precondtioning as part of 'Thinking Ahead' benefit a programmer when writing code?


Convert 10101100 to decimal.


What is the difference between a dynamic and a static data structure?


Write a small program, in pseudocode or otherwise, that demonstrates a recursive algorithm. Write a small explanation of how recursion is used in your program.