Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)
CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water
SN
Related Chemistry A Level answers
All answers ▸Define the term standard electrode potential
Why does phenol react more readily with bromine than benzene?
What is the difference between a Bronsted Lowry acid and a Lewis Acid?
At 25 °C, the initial rate of reaction is 3.1 × 10−3 mol dm−3 s−1 when the initial concentration of C is 0.48 mol dm−3 and the initial concentration of D is 0.23 mol dm−3 . Calculate a value for the rate constant at this T when rate = k [C][D].