Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

What is the trend in reactivity of Group 2 elements with halogens as the group is descended?


A buffer solution was formed by mixing 20.0 cm^3 of sodium hydroxide solution of concentration 0.100 mol dm^–3 with 25.0 cm^3 of ethanoic acid of concentration 0.150 mol dm^–3. CH3COOH + NaOH---CH3COONa + H2O Calculate the pH of this buffer solution.


Explain the trend in the first ionisation energies of the group 1 elements


What is the electron arrangement for a Co atom?