Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)
CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water
SN
Related Chemistry A Level answers
All answers ▸What evidences are used to prove that Benzene's kekule model is incorrect and that Benzene has a delocalised Pi structure.
Calculate the empirical and molecular formula of the molecule giving rise to the molecular ion peak at 148 m/z. The percentage composition by weight is 64.80 % carbon, 13.62 % hydrogen, and 21.58 % oxygen
The reversible reaction of sulfur dioxide and oxygen to form sulfur trioxide is shown below. 2SO2(g) + O2(g) 2SO3(g) An equilibrium mixture contains 2.4mol SO2, 1.2mol O2 and 0.4mol SO3. The total pressure is 250atm. What is the p(SO3)?
Why does the solubility of Group 2 hydroxides in water increase down the group?