Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

1898 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

Explain why the enthalpy of lattice dissociation of potassium oxide is less endothermic than that of sodium oxide. ( 2 Marks)


"Sulfur Dioxide can be represented as a sulfur atom with double bonds to each of two oxygen atoms, explain the shape of this molecule and predict the bond angle".


Describe the conditions used in the Haber Process and explain briefly why they are used.


0.04 moles of sulfur trioxide is placed in a flask (1.50dm^3) and allowed to reach equilibrium at 600 degrees. If 30% of the sulfur trioxide decomposes to sulfur dioxide and oxygen - what is the equilibrium constant?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning