Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2114 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

What product is formed upon addition of dimethylamine to ethanoyl chloride? Provide a curly-arrow mechanism for the formation of this product.


Describe and explain the electrical conductivity of lithium oxide, Li2O, and lithium in their solid and molten states.


What is the difference between intermolecular and intramolecular bonds.


How does the structure and bonding of alkanes differ to that of alkenes?


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning