Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Consider the following reaction: C2H4 + HBr -> ?. a) What is the product of the reaction? Name the compound and give the structural formula. b) What is the type of the reaction? c) Draw a reaction mechanism.


How do I test for the presence of a carboxylic acid?


What is the difference between intermolecular and intramolecular bonds.


Why is methylamine a stronger base than phenylamine?