Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Explain the trend in ionization energy down a group of the periodic table.


When you are given a table of half cells with values for electrode potentials, how do you find the strongest oxidising and reducing agent?


Can you explain acylation?


"A chromium compound contains 28.4% sodium and 32.1% chromium by mass, while the rest is oxygen. What is the empirical formula of this compound?"