Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

This question is about the ionisation energy of elements across a period. a) Define ionisation energy. b) Explain the trend in ionisation energy across a period.


why does graphene conduct electricity?


The Haber process is used to manufacture ammonia. Explain the optimum conditions for this reaction and why these conditions may not be used in industry


How do you describe the process of recrystallisation to purify a product?