Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN

Related Chemistry A Level answers

All answers ▸

Why are Amines more basic than Amides?


1. X with 2,4-DNPH forms a red precipitate. 2. X reduces blue Copper ions into red precipitate. What kind of compound is X?


Explain why ionic compounds (e.g. NaCl) are soluble, and why they conduct electricity in this state.


Explain and draw the mechanism of the nucleophillic substitution reaction between bromoethane and aqueous sodium hydroxide. How is this reaction different to the elimination reaction which may occur?