Describe a two step reaction route that can convert 1-Butene (CH2CHCH2CH3) into a compound that is more soluble in water. Use mechanisms to aid your answer (HINT: one of the steps involves nucleophilic substitution)

CH2CHCH2CH3 + HBr (room temp) --> CH3CH(Br)CH2CH3CH3CH(Br)CH2CH3 + NaOH (reflux) --> CH3CH(OH)CH2CH3Mechanism can be done on lesson spaceFinal product is more water soluble as the OH group will enable it to form hydrogen bonds with water

SN
Answered by Sean N. Chemistry tutor

2063 Views

See similar Chemistry A Level tutors

Related Chemistry A Level answers

All answers ▸

By comparing the forces involved, explain why hydrogen iodide (HI) would have a higher boiling point than hydrogen bromide (HBr)?


What is the order of decreasing acidity for the molecules phenol, ethanoic acid and ethanol? Why?


What are the shape of p orbitals?


Explain why the product of a nucleophilic addition to butanone does not effect plane polarized light.


We're here to help

contact us iconContact ustelephone icon+44 (0) 203 773 6020
Facebook logoInstagram logoLinkedIn logo

MyTutor is part of the IXL family of brands:

© 2026 by IXL Learning